C31H30F5N3O5 — CID 58972527
2-ethoxy-N-[(7S)-6-oxo-5-(2-phenylmethoxyethyl)-7H-benzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 58972527) has the molecular formula C31H30F5N3O5 and a molecular weight of 619.59 g/mol. Its IUPAC name is 2-ethoxy-N-[(7S)-6-oxo-5-(2-phenylmethoxyethyl)-7H-benzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | 2-ethoxy-N-[(7S)-6-oxo-5-(2-phenylmethoxyethyl)-7H-benzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 58972527 |
| Molecular Formula | C31H30F5N3O5 |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 2-ethoxy-N-[(7S)-6-oxo-5-(2-phenylmethoxyethyl)-7H-benzo[d][1]benzazepin-7-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | CCOC(C(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@@H]1C(=O)N(CCOCc2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H30F5N3O5/c1-2-44-26(27(40)37-19-30(32,33)31(34,35)36)28(41)38-25-23-14-7-6-12-21(23)22-13-8-9-15-24(22)39(29(25)42)16-17-43-18-20-10-4-3-5-11-20/h3-15,25-26H,2,16-19H2,1H3,(H,37,40)(H,38,41)/t25-,26?/m0/s1 |
| InChIKey | BJXMLWHFIQJMCH-PMCHYTPCSA-N |
| XLogP | 4.79 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|