C27H28F8N4O5 — CID 87691847
(2R)-2-hydroxy-2-methyl-N-[(3S)-4-oxo-1-(2-phenylmethoxyethyl)-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 87691847) has the molecular formula C27H28F8N4O5 and a molecular weight of 640.53 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-methyl-N-[(3S)-4-oxo-1-(2-phenylmethoxyethyl)-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | (2R)-2-hydroxy-2-methyl-N-[(3S)-4-oxo-1-(2-phenylmethoxyethyl)-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 87691847 |
| Molecular Formula | C27H28F8N4O5 |
| Molecular Weight | 640.53 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | (2R)-2-hydroxy-2-methyl-N-[(3S)-4-oxo-1-(2-phenylmethoxyethyl)-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | C[C@@](O)(C(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@H]1CN(CCOCc2ccccc2)c2ccccc2N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C27H28F8N4O5/c1-24(43,22(41)36-15-25(28,29)27(33,34)35)23(42)37-18-13-38(11-12-44-14-17-7-3-2-4-8-17)19-9-5-6-10-20(19)39(21(18)40)16-26(30,31)32/h2-10,18,43H,11-16H2,1H3,(H,36,41)(H,37,42)/t18-,24+/m0/s1 |
| InChIKey | HWKUBQXBKMSLJR-MHECFPHRSA-N |
| XLogP | 3.17 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|