C28H25FN2O5 — CID 143546223
(2R)-2-fluoro-2-methyl-3-oxo-3-[[(Z)-[6-oxo-5-(2-phenylmethoxyethyl)benzo[d][1]benzazepin-7-ylidene]methyl]amino]propanoic acid (PubChem CID 143546223) has the molecular formula C28H25FN2O5 and a molecular weight of 488.52 g/mol. Its IUPAC name is (2R)-2-fluoro-2-methyl-3-oxo-3-[[(Z)-[6-oxo-5-(2-phenylmethoxyethyl)benzo[d][1]benzazepin-7-ylidene]methyl]amino]propanoic acid.
| Compound Name | (2R)-2-fluoro-2-methyl-3-oxo-3-[[(Z)-[6-oxo-5-(2-phenylmethoxyethyl)benzo[d][1]benzazepin-7-ylidene]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 143546223 |
| Molecular Formula | C28H25FN2O5 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (2R)-2-fluoro-2-methyl-3-oxo-3-[[(Z)-[6-oxo-5-(2-phenylmethoxyethyl)benzo[d][1]benzazepin-7-ylidene]methyl]amino]propanoic acid |
| SMILES | C[C@](F)(C(=O)O)C(=O)N/C=C1\C(=O)N(CCOCc2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H25FN2O5/c1-28(29,27(34)35)26(33)30-17-23-21-12-6-5-11-20(21)22-13-7-8-14-24(22)31(25(23)32)15-16-36-18-19-9-3-2-4-10-19/h2-14,17H,15-16,18H2,1H3,(H,30,33)(H,34,35)/b23-17-/t28-/m1/s1 |
| InChIKey | SRGSKDCXLUIINB-ZLXXADCTSA-N |
| XLogP | 4.19 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|