C18H19F6NO4 — CID 134195963
2-[2-[2,2-difluoro-3-methyl-3-(1,1,2,2-tetrafluoropropoxy)butoxy]ethyl]isoindole-1,3-dione (PubChem CID 134195963) has the molecular formula C18H19F6NO4 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-[2-[2,2-difluoro-3-methyl-3-(1,1,2,2-tetrafluoropropoxy)butoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2,2-difluoro-3-methyl-3-(1,1,2,2-tetrafluoropropoxy)butoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134195963 |
| Molecular Formula | C18H19F6NO4 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[2-[2,2-difluoro-3-methyl-3-(1,1,2,2-tetrafluoropropoxy)butoxy]ethyl]isoindole-1,3-dione |
| SMILES | CC(F)(F)C(F)(F)OC(C)(C)C(F)(F)COCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19F6NO4/c1-15(2,29-18(23,24)16(3,19)20)17(21,22)10-28-9-8-25-13(26)11-6-4-5-7-12(11)14(25)27/h4-7H,8-10H2,1-3H3 |
| InChIKey | RBVMFAMBMGVXJT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|