C17H13F10NO6 — CID 158403736
2-[2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethoxy]ethoxy]ethyl]isoindole-1,3-dione (PubChem CID 158403736) has the molecular formula C17H13F10NO6 and a molecular weight of 517.27 g/mol. Its IUPAC name is 2-[2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethoxy]ethoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158403736 |
| Molecular Formula | C17H13F10NO6 |
| Molecular Weight | 517.27 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 2-[2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
| SMILES | COC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13F10NO6/c1-31-14(20,21)15(22,23)34-17(26,27)16(24,25)33-13(18,19)8-32-7-6-28-11(29)9-4-2-3-5-10(9)12(28)30/h2-5H,6-8H2,1H3 |
| InChIKey | PLJWSMBRFAZTSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|