C18H18F8N4O5S — CID 86596838
2-methyl-N-[(3S)-1-methyl-2-oxo-5-(trifluoromethylsulfonyl)-3,4-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 86596838) has the molecular formula C18H18F8N4O5S and a molecular weight of 554.42 g/mol. Its IUPAC name is 2-methyl-N-[(3S)-1-methyl-2-oxo-5-(trifluoromethylsulfonyl)-3,4-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | 2-methyl-N-[(3S)-1-methyl-2-oxo-5-(trifluoromethylsulfonyl)-3,4-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 86596838 |
| Molecular Formula | C18H18F8N4O5S |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 2-methyl-N-[(3S)-1-methyl-2-oxo-5-(trifluoromethylsulfonyl)-3,4-dihydro-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | CC(C(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@H]1CN(S(=O)(=O)C(F)(F)F)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C18H18F8N4O5S/c1-9(13(31)27-8-16(19,20)17(21,22)23)14(32)28-10-7-30(36(34,35)18(24,25)26)12-6-4-3-5-11(12)29(2)15(10)33/h3-6,9-10H,7-8H2,1-2H3,(H,27,31)(H,28,32)/t9?,10-/m0/s1 |
| InChIKey | UEWCWDVCLRNWMG-AXDSSHIGSA-N |
| XLogP | 1.75 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|