C24H24F4N2O3 — CID 58973200
5-[[(1S,2R,4S)-4,6-diethyl-7-fluoro-2,5-dihydroxy-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-1H-quinolin-2-one (PubChem CID 58973200) has the molecular formula C24H24F4N2O3 and a molecular weight of 464.46 g/mol. Its IUPAC name is 5-[[(1S,2R,4S)-4,6-diethyl-7-fluoro-2,5-dihydroxy-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-1H-quinolin-2-one.
| Compound Name | 5-[[(1S,2R,4S)-4,6-diethyl-7-fluoro-2,5-dihydroxy-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58973200 |
| Molecular Formula | C24H24F4N2O3 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 5-[[(1S,2R,4S)-4,6-diethyl-7-fluoro-2,5-dihydroxy-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-1H-quinolin-2-one |
| SMILES | CCc1c(F)cc2c(c1O)[C@@H](CC)C[C@](O)(C(F)(F)F)[C@H]2Nc1cccc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C24H24F4N2O3/c1-3-12-11-23(33,24(26,27)28)22(15-10-16(25)13(4-2)21(32)20(12)15)30-18-7-5-6-17-14(18)8-9-19(31)29-17/h5-10,12,22,30,32-33H,3-4,11H2,1-2H3,(H,29,31)/t12-,22-,23+/m0/s1 |
| InChIKey | DQVOAZULHKYDLJ-PVKVWUIVSA-N |
| XLogP | 5.28 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |