C11H14O2S — CID 58973629
methyl 2-(5-but-3-enylthiophen-2-yl)acetate (PubChem CID 58973629) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is methyl 2-(5-but-3-enylthiophen-2-yl)acetate.
| Compound Name | methyl 2-(5-but-3-enylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 58973629 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | methyl 2-(5-but-3-enylthiophen-2-yl)acetate |
| SMILES | C=CCCc1ccc(CC(=O)OC)s1 |
| InChI | InChI=1S/C11H14O2S/c1-3-4-5-9-6-7-10(14-9)8-11(12)13-2/h3,6-7H,1,4-5,8H2,2H3 |
| InChIKey | DKXHAKOMWMNAGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|