C22H39NS — CID 58980352
2-(2-ethylhexylsulfanyl)-5-(2,4,4-trimethylpentan-2-yl)aniline (PubChem CID 58980352) has the molecular formula C22H39NS and a molecular weight of 349.63 g/mol. Its IUPAC name is 2-(2-ethylhexylsulfanyl)-5-(2,4,4-trimethylpentan-2-yl)aniline.
| Compound Name | 2-(2-ethylhexylsulfanyl)-5-(2,4,4-trimethylpentan-2-yl)aniline |
|---|---|
| PubChem CID | 58980352 |
| Molecular Formula | C22H39NS |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 2-(2-ethylhexylsulfanyl)-5-(2,4,4-trimethylpentan-2-yl)aniline |
| SMILES | CCCCC(CC)CSc1ccc(C(C)(C)CC(C)(C)C)cc1N |
| InChI | InChI=1S/C22H39NS/c1-8-10-11-17(9-2)15-24-20-13-12-18(14-19(20)23)22(6,7)16-21(3,4)5/h12-14,17H,8-11,15-16,23H2,1-7H3 |
| InChIKey | VNDGIRHADNMURD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|