C18H31NS — CID 93481454
5-tert-butyl-2-[(2R)-2-ethylhexyl]sulfanylaniline (PubChem CID 93481454) has the molecular formula C18H31NS and a molecular weight of 293.52 g/mol. Its IUPAC name is 5-tert-butyl-2-[(2R)-2-ethylhexyl]sulfanylaniline.
| Compound Name | 5-tert-butyl-2-[(2R)-2-ethylhexyl]sulfanylaniline |
|---|---|
| PubChem CID | 93481454 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 5-tert-butyl-2-[(2R)-2-ethylhexyl]sulfanylaniline |
| SMILES | CCCC[C@@H](CC)CSc1ccc(C(C)(C)C)cc1N |
| InChI | InChI=1S/C18H31NS/c1-6-8-9-14(7-2)13-20-17-11-10-15(12-16(17)19)18(3,4)5/h10-12,14H,6-9,13,19H2,1-5H3/t14-/m1/s1 |
| InChIKey | AVLSDPRGRUUKBD-CQSZACIVSA-N |
| XLogP | 5.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|