About 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene
1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene (PubChem CID 134850947) has the molecular formula C20H34O
and a molecular weight of 290.49 g/mol. Its IUPAC name is 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene |
| PubChem CID | 134850947 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene |
| SMILES | CCCC[C@H](CC)C[C@H](OC)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34O/c1-7-9-10-16(8-2)15-19(21-6)17-11-13-18(14-12-17)20(3,4)5/h11-14,16,19H,7-10,15H2,1-6H3/t16-,19-/m0/s1 |
| InChIKey | CZASNFFDKIUIAO-LPHOPBHVSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene?
The IUPAC name of 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene (CID 134850947) is 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene.
What is the SMILES notation for 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene?
The canonical SMILES for 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene is CCCC[C@H](CC)C[C@H](OC)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene?
The InChIKey is CZASNFFDKIUIAO-LPHOPBHVSA-N. The full InChI is InChI=1S/C20H34O/c1-7-9-10-16(8-2)15-19(21-6)17-11-13-18(14-12-17)20(3,4)5/h11-14,16,19H,7-10,15H2,1-6H3/t16-,19-/m0/s1.
What are the key properties of 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene?
1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene has a molecular weight of 290.49 g/mol, XLogP of 6.28, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[(1S,3S)-3-ethyl-1-methoxyheptyl]benzene is sourced from PubChem (CID 134850947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).