C19H42 — CID 143303166
3-tert-butyl-5-ethyl-2,2-dimethylnonane;ethane (PubChem CID 143303166) has the molecular formula C19H42 and a molecular weight of 270.54 g/mol. Its IUPAC name is 3-tert-butyl-5-ethyl-2,2-dimethylnonane;ethane.
| Compound Name | 3-tert-butyl-5-ethyl-2,2-dimethylnonane;ethane |
|---|---|
| PubChem CID | 143303166 |
| Molecular Formula | C19H42 |
| Molecular Weight | 270.54 g/mol |
| Exact Mass | 270.33 |
| IUPAC Name | 3-tert-butyl-5-ethyl-2,2-dimethylnonane;ethane |
| SMILES | CC.CCCCC(CC)CC(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36.C2H6/c1-9-11-12-14(10-2)13-15(16(3,4)5)17(6,7)8;1-2/h14-15H,9-13H2,1-8H3;1-2H3 |
| InChIKey | KNHPAPKVCINFBZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |