About 6,6-dimethyl-2-phenyl-1,3-oxazine
6,6-dimethyl-2-phenyl-1,3-oxazine (PubChem CID 58983033) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 6,6-dimethyl-2-phenyl-1,3-oxazine.
Molecular Properties
| Compound Name | 6,6-dimethyl-2-phenyl-1,3-oxazine |
| PubChem CID | 58983033 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 6,6-dimethyl-2-phenyl-1,3-oxazine |
| SMILES | CC1(C)C=CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C12H13NO/c1-12(2)8-9-13-11(14-12)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | XWSOHYRNTYHUCV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-2-phenyl-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2-phenyl-1,3-oxazine?
The IUPAC name of 6,6-dimethyl-2-phenyl-1,3-oxazine (CID 58983033) is 6,6-dimethyl-2-phenyl-1,3-oxazine.
What is the SMILES notation for 6,6-dimethyl-2-phenyl-1,3-oxazine?
The canonical SMILES for 6,6-dimethyl-2-phenyl-1,3-oxazine is CC1(C)C=CN=C(c2ccccc2)O1.
What is the InChIKey of 6,6-dimethyl-2-phenyl-1,3-oxazine?
The InChIKey is XWSOHYRNTYHUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-12(2)8-9-13-11(14-12)10-6-4-3-5-7-10/h3-9H,1-2H3.
What are the key properties of 6,6-dimethyl-2-phenyl-1,3-oxazine?
6,6-dimethyl-2-phenyl-1,3-oxazine has a molecular weight of 187.24 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2-phenyl-1,3-oxazine is sourced from PubChem (CID 58983033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).