About iridium;6-phenylpyridine-2,5-dione
iridium;6-phenylpyridine-2,5-dione (PubChem CID 58983304) has the molecular formula C11H6IrNO2-
and a molecular weight of 376.39 g/mol. Its IUPAC name is iridium;6-phenylpyridine-2,5-dione.
Molecular Properties
| Compound Name | iridium;6-phenylpyridine-2,5-dione |
| PubChem CID | 58983304 |
| Molecular Formula | C11H6IrNO2- |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | iridium;6-phenylpyridine-2,5-dione |
| SMILES | O=C1C=CC(=O)C(c2[c-]cccc2)=N1.[Ir] |
| InChI | InChI=1S/C11H6NO2.Ir/c13-9-6-7-10(14)12-11(9)8-4-2-1-3-5-8;/h1-4,6-7H;/q-1; |
| InChIKey | ANVBJEWEEXZLNV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;6-phenylpyridine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;6-phenylpyridine-2,5-dione?
The IUPAC name of iridium;6-phenylpyridine-2,5-dione (CID 58983304) is iridium;6-phenylpyridine-2,5-dione.
What is the SMILES notation for iridium;6-phenylpyridine-2,5-dione?
The canonical SMILES for iridium;6-phenylpyridine-2,5-dione is O=C1C=CC(=O)C(c2[c-]cccc2)=N1.[Ir].
What is the InChIKey of iridium;6-phenylpyridine-2,5-dione?
The InChIKey is ANVBJEWEEXZLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6NO2.Ir/c13-9-6-7-10(14)12-11(9)8-4-2-1-3-5-8;/h1-4,6-7H;/q-1;.
What are the key properties of iridium;6-phenylpyridine-2,5-dione?
iridium;6-phenylpyridine-2,5-dione has a molecular weight of 376.39 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;6-phenylpyridine-2,5-dione is sourced from PubChem (CID 58983304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).