C9H12N12O3 — CID 58984267
1,3,5-tris(2-azidoethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 58984267) has the molecular formula C9H12N12O3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 1,3,5-tris(2-azidoethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(2-azidoethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58984267 |
| Molecular Formula | C9H12N12O3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1,3,5-tris(2-azidoethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | [N-]=[N+]=NCCn1c(=O)n(CCN=[N+]=[N-])c(=O)n(CCN=[N+]=[N-])c1=O |
| InChI | InChI=1S/C9H12N12O3/c10-16-13-1-4-19-7(22)20(5-2-14-17-11)9(24)21(8(19)23)6-3-15-18-12/h1-6H2 |
| InChIKey | VVRXETIDNQDJNX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 212.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|