About 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine
5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine (PubChem CID 58984556) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine.
Analyze 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine?
The IUPAC name of 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine (CID 58984556) is 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine.
What is the SMILES notation for 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine?
The canonical SMILES for 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine is C=C1CNCCN=C1C.
What is the InChIKey of 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine?
The InChIKey is NILHHIPQJGADIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-6-5-8-3-4-9-7(6)2/h8H,1,3-5H2,2H3.
What are the key properties of 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine?
5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine has a molecular weight of 124.19 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-methylidene-1,2,3,7-tetrahydro-1,4-diazepine is sourced from PubChem (CID 58984556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).