C7H15N3 — CID 148562153
(Z)-2-(C,N-dimethylcarbonimidoyl)-N'-methylprop-1-ene-1,3-diamine (PubChem CID 148562153) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (Z)-2-(C,N-dimethylcarbonimidoyl)-N'-methylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-N'-methylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 148562153 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-N'-methylprop-1-ene-1,3-diamine |
| SMILES | C/N=C(C)/C(=C\N)CNC |
| InChI | InChI=1S/C7H15N3/c1-6(10-3)7(4-8)5-9-2/h4,9H,5,8H2,1-3H3/b7-4-,10-6+ |
| InChIKey | MVEZAHMNLOLMBV-HLWKLQMVSA-N |
| XLogP | 0.14 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|