C11H22N2 — CID 142057454
(E)-3-(but-3-en-2-ylideneamino)-N,2-dimethylprop-2-en-1-amine;ethane (PubChem CID 142057454) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (E)-3-(but-3-en-2-ylideneamino)-N,2-dimethylprop-2-en-1-amine;ethane.
| Compound Name | (E)-3-(but-3-en-2-ylideneamino)-N,2-dimethylprop-2-en-1-amine;ethane |
|---|---|
| PubChem CID | 142057454 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (E)-3-(but-3-en-2-ylideneamino)-N,2-dimethylprop-2-en-1-amine;ethane |
| SMILES | C=C/C(C)=N/C=C(\C)CNC.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-5-9(3)11-7-8(2)6-10-4;1-2/h5,7,10H,1,6H2,2-4H3;1-2H3/b8-7+,11-9+; |
| InChIKey | ZXKDHAHHIMRUHW-LOAFRIKVSA-N |
| XLogP | 2.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|