C19H20BrN3O2 — CID 58986051
1-(4-bromophenyl)-2-[2-(3-hydroxypropylimino)-3-methylbenzimidazol-1-yl]ethanone (PubChem CID 58986051) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[2-(3-hydroxypropylimino)-3-methylbenzimidazol-1-yl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[2-(3-hydroxypropylimino)-3-methylbenzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 58986051 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-(4-bromophenyl)-2-[2-(3-hydroxypropylimino)-3-methylbenzimidazol-1-yl]ethanone |
| SMILES | Cn1/c(=N\CCCO)n(CC(=O)c2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H20BrN3O2/c1-22-16-5-2-3-6-17(16)23(19(22)21-11-4-12-24)13-18(25)14-7-9-15(20)10-8-14/h2-3,5-10,24H,4,11-13H2,1H3/b21-19+ |
| InChIKey | SNCLBXPVYSTVEC-XUTLUUPISA-N |
| XLogP | 2.91 |
| TPSA | 59.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|