C27H27ClN2O3 — CID 58992588
methyl 3-[3-[[4-(4-chlorophenyl)phenyl]methylcarbamoyl]piperidin-1-yl]benzoate (PubChem CID 58992588) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is methyl 3-[3-[[4-(4-chlorophenyl)phenyl]methylcarbamoyl]piperidin-1-yl]benzoate.
| Compound Name | methyl 3-[3-[[4-(4-chlorophenyl)phenyl]methylcarbamoyl]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 58992588 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl 3-[3-[[4-(4-chlorophenyl)phenyl]methylcarbamoyl]piperidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2CCCC(C(=O)NCc3ccc(-c4ccc(Cl)cc4)cc3)C2)c1 |
| InChI | InChI=1S/C27H27ClN2O3/c1-33-27(32)22-4-2-6-25(16-22)30-15-3-5-23(18-30)26(31)29-17-19-7-9-20(10-8-19)21-11-13-24(28)14-12-21/h2,4,6-14,16,23H,3,5,15,17-18H2,1H3,(H,29,31) |
| InChIKey | IMSJYNFKDIVZAM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |