C23H25ClN4O2 — CID 97047786
(3S)-N-[(4-chlorophenyl)methyl]-1-(3-ethoxyquinoxalin-2-yl)piperidine-3-carboxamide (PubChem CID 97047786) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (3S)-N-[(4-chlorophenyl)methyl]-1-(3-ethoxyquinoxalin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(4-chlorophenyl)methyl]-1-(3-ethoxyquinoxalin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97047786 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3S)-N-[(4-chlorophenyl)methyl]-1-(3-ethoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| SMILES | CCOc1nc2ccccc2nc1N1CCC[C@H](C(=O)NCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H25ClN4O2/c1-2-30-23-21(26-19-7-3-4-8-20(19)27-23)28-13-5-6-17(15-28)22(29)25-14-16-9-11-18(24)12-10-16/h3-4,7-12,17H,2,5-6,13-15H2,1H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | OXEXJRNDOZIKAS-KRWDZBQOSA-N |
| XLogP | 4.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |