C22H30N4O2 — CID 93052335
[(3S)-1-(3-ethoxyquinoxalin-2-yl)piperidin-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 93052335) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is [(3S)-1-(3-ethoxyquinoxalin-2-yl)piperidin-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(3S)-1-(3-ethoxyquinoxalin-2-yl)piperidin-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 93052335 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [(3S)-1-(3-ethoxyquinoxalin-2-yl)piperidin-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCOc1nc2ccccc2nc1N1CCC[C@H](C(=O)N2CCC(C)CC2)C1 |
| InChI | InChI=1S/C22H30N4O2/c1-3-28-21-20(23-18-8-4-5-9-19(18)24-21)26-12-6-7-17(15-26)22(27)25-13-10-16(2)11-14-25/h4-5,8-9,16-17H,3,6-7,10-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | ASJVNAHOPPBGKW-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |