C27H33N5O — CID 58993765
N-[4-[1-(dimethylamino)cyclobutyl]-2-spiro[4.5]dec-8-en-8-ylphenyl]-5-isocyano-1H-imidazole-2-carboxamide (PubChem CID 58993765) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is N-[4-[1-(dimethylamino)cyclobutyl]-2-spiro[4.5]dec-8-en-8-ylphenyl]-5-isocyano-1H-imidazole-2-carboxamide.
| Compound Name | N-[4-[1-(dimethylamino)cyclobutyl]-2-spiro[4.5]dec-8-en-8-ylphenyl]-5-isocyano-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58993765 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | N-[4-[1-(dimethylamino)cyclobutyl]-2-spiro[4.5]dec-8-en-8-ylphenyl]-5-isocyano-1H-imidazole-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2ccc(C3(N(C)C)CCC3)cc2C2=CCC3(CCCC3)CC2)[nH]1 |
| InChI | InChI=1S/C27H33N5O/c1-28-23-18-29-24(31-23)25(33)30-22-8-7-20(27(32(2)3)13-6-14-27)17-21(22)19-9-15-26(16-10-19)11-4-5-12-26/h7-9,17-18H,4-6,10-16H2,2-3H3,(H,29,31)(H,30,33) |
| InChIKey | YTSALHUWTBXDNP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|