C26H28N6O — CID 58994448
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[2-(pyridin-2-ylamino)ethyl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide (PubChem CID 58994448) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[2-(pyridin-2-ylamino)ethyl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[2-(pyridin-2-ylamino)ethyl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994448 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[2-(pyridin-2-ylamino)ethyl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2ccc(CCNc3ccccn3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C26H28N6O/c1-26(2)12-9-19(10-13-26)20-16-18(11-15-29-22-6-4-5-14-28-22)7-8-21(20)31-25(33)24-30-17-23(27-3)32-24/h4-9,14,16-17H,10-13,15H2,1-2H3,(H,28,29)(H,30,32)(H,31,33) |
| InChIKey | HKMDLIFCNBFUOU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|