C16H15ClN2O3 — CID 58994734
4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid (PubChem CID 58994734) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid.
| Compound Name | 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 58994734 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C16H15ClN2O3/c1-9-4-3-5-10(2)14(9)19-16(22)18-13-8-11(17)6-7-12(13)15(20)21/h3-8H,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | RNAHNGOMLVSYIU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |