4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid

C16H15ClN2O3 — CID 58994734

IUPAC4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid
SMILESCc1cccc(C)c1NC(=O)Nc1cc(Cl)ccc1C(=O)O
InChIInChI=1S/C16H15ClN2O3/c1-9-4-3-5-10(2)14(9)19-16(22)18-13-8-11(17)6-7-12(13)15(20)21/h3-8H,1-2H3,(H,20,21)(H2,18,19,22)
InChIKeyRNAHNGOMLVSYIU-UHFFFAOYSA-N
MW318.76 g/mol
LogP4.30
Rot. Bonds3

About 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid

4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid (PubChem CID 58994734) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid.

Molecular Properties

Compound Name4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid
PubChem CID58994734
Molecular FormulaC16H15ClN2O3
Molecular Weight318.76 g/mol
Exact Mass318.08
IUPAC Name4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid
SMILESCc1cccc(C)c1NC(=O)Nc1cc(Cl)ccc1C(=O)O
InChIInChI=1S/C16H15ClN2O3/c1-9-4-3-5-10(2)14(9)19-16(22)18-13-8-11(17)6-7-12(13)15(20)21/h3-8H,1-2H3,(H,20,21)(H2,18,19,22)
InChIKeyRNAHNGOMLVSYIU-UHFFFAOYSA-N
XLogP4.30
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.76
LogP ≤ 54.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid?
The IUPAC name of 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid (CID 58994734) is 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid.
What is the SMILES notation for 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid?
The canonical SMILES for 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid is Cc1cccc(C)c1NC(=O)Nc1cc(Cl)ccc1C(=O)O.
What is the InChIKey of 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid?
The InChIKey is RNAHNGOMLVSYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O3/c1-9-4-3-5-10(2)14(9)19-16(22)18-13-8-11(17)6-7-12(13)15(20)21/h3-8H,1-2H3,(H,20,21)(H2,18,19,22).
What are the key properties of 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid?
4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid has a molecular weight of 318.76 g/mol, XLogP of 4.30, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(2,6-dimethylphenyl)carbamoylamino]benzoic acid is sourced from PubChem (CID 58994734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).