C16H9ClF6N2O3 — CID 11293246
2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-4-chlorobenzoic acid (PubChem CID 11293246) has the molecular formula C16H9ClF6N2O3 and a molecular weight of 426.70 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-4-chlorobenzoic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 11293246 |
| Molecular Formula | C16H9ClF6N2O3 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-4-chlorobenzoic acid |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C16H9ClF6N2O3/c17-9-1-2-11(13(26)27)12(6-9)25-14(28)24-10-4-7(15(18,19)20)3-8(5-10)16(21,22)23/h1-6H,(H,26,27)(H2,24,25,28) |
| InChIKey | BNJQNYCKEWQMPU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |