C35H51N7O2 — CID 58994951
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1,2,2,6,6-pentamethyl-4-(2-morpholin-4-ylethylamino)piperidin-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide (PubChem CID 58994951) has the molecular formula C35H51N7O2 and a molecular weight of 601.84 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1,2,2,6,6-pentamethyl-4-(2-morpholin-4-ylethylamino)piperidin-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1,2,2,6,6-pentamethyl-4-(2-morpholin-4-ylethylamino)piperidin-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994951 |
| Molecular Formula | C35H51N7O2 |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1,2,2,6,6-pentamethyl-4-(2-morpholin-4-ylethylamino)piperidin-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2ccc(C3(NCCN4CCOCC4)CC(C)(C)N(C)C(C)(C)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C35H51N7O2/c1-32(2)13-11-25(12-14-32)27-21-26(9-10-28(27)39-31(43)30-37-22-29(36-7)40-30)35(38-15-16-42-17-19-44-20-18-42)23-33(3,4)41(8)34(5,6)24-35/h9-11,21-22,38H,12-20,23-24H2,1-6,8H3,(H,37,40)(H,39,43) |
| InChIKey | VRCGXQKDGGDKCX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|