C38H24N4O6 — CID 58995891
6,13-bis(3-phenylmethoxy-2-pyridinyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 58995891) has the molecular formula C38H24N4O6 and a molecular weight of 632.63 g/mol. Its IUPAC name is 6,13-bis(3-phenylmethoxy-2-pyridinyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(3-phenylmethoxy-2-pyridinyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58995891 |
| Molecular Formula | C38H24N4O6 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 6,13-bis(3-phenylmethoxy-2-pyridinyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ncccc1OCc1ccccc1)C(=O)N(c1ncccc1OCc1ccccc1)C3=O |
| InChI | InChI=1S/C38H24N4O6/c43-35-25-15-17-27-32-28(38(46)42(37(27)45)34-30(14-8-20-40-34)48-22-24-11-5-2-6-12-24)18-16-26(31(25)32)36(44)41(35)33-29(13-7-19-39-33)47-21-23-9-3-1-4-10-23/h1-20H,21-22H2 |
| InChIKey | LXKXXGHSPPMJCB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|