C20H28N6O — CID 58997019
4-[bis[(3-methyl-2-pyridinyl)methyl]amino]piperidine-1-carbohydrazide (PubChem CID 58997019) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 4-[bis[(3-methyl-2-pyridinyl)methyl]amino]piperidine-1-carbohydrazide.
| Compound Name | 4-[bis[(3-methyl-2-pyridinyl)methyl]amino]piperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 58997019 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-[bis[(3-methyl-2-pyridinyl)methyl]amino]piperidine-1-carbohydrazide |
| SMILES | Cc1cccnc1CN(Cc1ncccc1C)C1CCN(C(=O)NN)CC1 |
| InChI | InChI=1S/C20H28N6O/c1-15-5-3-9-22-18(15)13-26(14-19-16(2)6-4-10-23-19)17-7-11-25(12-8-17)20(27)24-21/h3-6,9-10,17H,7-8,11-14,21H2,1-2H3,(H,24,27) |
| InChIKey | JPWSEEPGAPLRSS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|