C23H20N6O2 — CID 58997476
2-(4-isocyano-2-methylphenyl)-5-[5-(methoxymethyl)-4-(6-methoxy-3-pyridinyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 58997476) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-(4-isocyano-2-methylphenyl)-5-[5-(methoxymethyl)-4-(6-methoxy-3-pyridinyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 2-(4-isocyano-2-methylphenyl)-5-[5-(methoxymethyl)-4-(6-methoxy-3-pyridinyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 58997476 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(4-isocyano-2-methylphenyl)-5-[5-(methoxymethyl)-4-(6-methoxy-3-pyridinyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3nnc(COC)n3-c3ccc(OC)nc3)cn2)c(C)c1 |
| InChI | InChI=1S/C23H20N6O2/c1-15-11-17(24-2)6-8-19(15)20-9-5-16(12-25-20)23-28-27-21(14-30-3)29(23)18-7-10-22(31-4)26-13-18/h5-13H,14H2,1,3-4H3 |
| InChIKey | PQSAHXDILOEUKG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|