C21H17N7O — CID 58997481
2-(5-isocyano-2-methylphenyl)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine (PubChem CID 58997481) has the molecular formula C21H17N7O and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(5-isocyano-2-methylphenyl)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine.
| Compound Name | 2-(5-isocyano-2-methylphenyl)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 58997481 |
| Molecular Formula | C21H17N7O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(5-isocyano-2-methylphenyl)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine |
| SMILES | [C-]#[N+]c1ccc(C)c(-c2cnc(-c3nnc(C)n3-c3ccc(OC)nc3)cn2)c1 |
| InChI | InChI=1S/C21H17N7O/c1-13-5-6-15(22-3)9-17(13)18-11-24-19(12-23-18)21-27-26-14(2)28(21)16-7-8-20(29-4)25-10-16/h5-12H,1-2,4H3 |
| InChIKey | UKGDKEVVMSJDJA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|