C5H6F3N3S — CID 58997891
1,4-dimethyl-5-(trifluoromethyl)-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 58997891) has the molecular formula C5H6F3N3S and a molecular weight of 197.19 g/mol. Its IUPAC name is 1,4-dimethyl-5-(trifluoromethyl)-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 1,4-dimethyl-5-(trifluoromethyl)-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 58997891 |
| Molecular Formula | C5H6F3N3S |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 1,4-dimethyl-5-(trifluoromethyl)-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | Cn1nc([S-])[n+](C)c1C(F)(F)F |
| InChI | InChI=1S/C5H6F3N3S/c1-10-3(5(6,7)8)11(2)9-4(10)12/h1-2H3 |
| InChIKey | AOWDLPYOBKMKIJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|