About CID 58998141
CID 58998141 (PubChem CID 58998141) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol.
Molecular Properties
| Compound Name | CID 58998141 |
| PubChem CID | 58998141 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | — |
| SMILES | [CH]C1(N2CCOCC2)CCN(C)CC1 |
| InChI | InChI=1S/C11H20N2O/c1-11(3-5-12(2)6-4-11)13-7-9-14-10-8-13/h1H,3-10H2,2H3 |
| InChIKey | RXIFIYFSYXZJMB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58998141 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58998141?
The IUPAC name of CID 58998141 (CID 58998141) is not available.
What is the SMILES notation for CID 58998141?
The canonical SMILES for CID 58998141 is [CH]C1(N2CCOCC2)CCN(C)CC1.
What is the InChIKey of CID 58998141?
The InChIKey is RXIFIYFSYXZJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-11(3-5-12(2)6-4-11)13-7-9-14-10-8-13/h1H,3-10H2,2H3.
What are the key properties of CID 58998141?
CID 58998141 has a molecular weight of 196.29 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58998141 is sourced from PubChem (CID 58998141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).