C31H43F2N4O6S — CID 58998851
CID 58998851 (PubChem CID 58998851) has the molecular formula C31H43F2N4O6S and a molecular weight of 637.77 g/mol.
| Compound Name | CID 58998851 |
|---|---|
| PubChem CID | 58998851 |
| Molecular Formula | C31H43F2N4O6S |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | — |
| SMILES | CCCCS(=O)(=O)C[C@@H](NC(=O)O[C@@H]1CCNC1)C(=O)N(Cc1cccc(CC)c1)C[C@@H](O)[C@@H]([NH])Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C31H43F2N4O6S/c1-3-5-11-44(41,42)20-28(36-31(40)43-26-9-10-35-17-26)30(39)37(18-22-8-6-7-21(4-2)12-22)19-29(38)27(34)15-23-13-24(32)16-25(33)14-23/h6-8,12-14,16,26-29,34-35,38H,3-5,9-11,15,17-20H2,1-2H3,(H,36,40)/t26-,27+,28-,29-/m1/s1 |
| InChIKey | GDQQBVGLVCXXJB-VJLHXPKFSA-N |
| XLogP | 2.78 |
| TPSA | 148.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |