C28H36F5N3O5S — CID 59756782
(2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-3-butylsulfonyl-N-[(3-ethylphenyl)methyl]-2-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 59756782) has the molecular formula C28H36F5N3O5S and a molecular weight of 621.67 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-3-butylsulfonyl-N-[(3-ethylphenyl)methyl]-2-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-3-butylsulfonyl-N-[(3-ethylphenyl)methyl]-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 59756782 |
| Molecular Formula | C28H36F5N3O5S |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-3-butylsulfonyl-N-[(3-ethylphenyl)methyl]-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | CCCCS(=O)(=O)C[C@@H](NC(=O)C(F)(F)F)C(=O)N(Cc1cccc(CC)c1)C[C@@H](O)[C@@H](N)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C28H36F5N3O5S/c1-3-5-9-42(40,41)17-24(35-27(39)28(31,32)33)26(38)36(15-19-8-6-7-18(4-2)10-19)16-25(37)23(34)13-20-11-21(29)14-22(30)12-20/h6-8,10-12,14,23-25,37H,3-5,9,13,15-17,34H2,1-2H3,(H,35,39)/t23-,24+,25+/m0/s1 |
| InChIKey | BCONTOBQLHXRKC-ISJGIBHGSA-N |
| XLogP | 3.05 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |