About bis(3-hydroxypropanoic acid);oxotitanium
bis(3-hydroxypropanoic acid);oxotitanium (PubChem CID 58999446) has the molecular formula C6H12O7Ti
and a molecular weight of 244.02 g/mol. Its IUPAC name is bis(3-hydroxypropanoic acid);oxotitanium.
Molecular Properties
| Compound Name | bis(3-hydroxypropanoic acid);oxotitanium |
| PubChem CID | 58999446 |
| Molecular Formula | C6H12O7Ti |
| Molecular Weight | 244.02 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | bis(3-hydroxypropanoic acid);oxotitanium |
| SMILES | O=C(O)CCO.O=C(O)CCO.O=[Ti] |
| InChI | InChI=1S/2C3H6O3.O.Ti/c2*4-2-1-3(5)6;;/h2*4H,1-2H2,(H,5,6);; |
| InChIKey | AGZGBXPCNOZYCO-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.02 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(3-hydroxypropanoic acid);oxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxypropanoic acid);oxotitanium?
The IUPAC name of bis(3-hydroxypropanoic acid);oxotitanium (CID 58999446) is bis(3-hydroxypropanoic acid);oxotitanium.
What is the SMILES notation for bis(3-hydroxypropanoic acid);oxotitanium?
The canonical SMILES for bis(3-hydroxypropanoic acid);oxotitanium is O=C(O)CCO.O=C(O)CCO.O=[Ti].
What is the InChIKey of bis(3-hydroxypropanoic acid);oxotitanium?
The InChIKey is AGZGBXPCNOZYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6O3.O.Ti/c2*4-2-1-3(5)6;;/h2*4H,1-2H2,(H,5,6);;.
What are the key properties of bis(3-hydroxypropanoic acid);oxotitanium?
bis(3-hydroxypropanoic acid);oxotitanium has a molecular weight of 244.02 g/mol, XLogP of -1.21, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxypropanoic acid);oxotitanium is sourced from PubChem (CID 58999446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).