C24H41N5O6 — CID 58999663
tert-butyl (3S,4E)-4-(carbamoylhydrazinylidene)-3-[[(2R)-2-(cyclohexylmethyl)-4-morpholin-4-yl-4-oxobutanoyl]amino]butanoate (PubChem CID 58999663) has the molecular formula C24H41N5O6 and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl (3S,4E)-4-(carbamoylhydrazinylidene)-3-[[(2R)-2-(cyclohexylmethyl)-4-morpholin-4-yl-4-oxobutanoyl]amino]butanoate.
| Compound Name | tert-butyl (3S,4E)-4-(carbamoylhydrazinylidene)-3-[[(2R)-2-(cyclohexylmethyl)-4-morpholin-4-yl-4-oxobutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 58999663 |
| Molecular Formula | C24H41N5O6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | tert-butyl (3S,4E)-4-(carbamoylhydrazinylidene)-3-[[(2R)-2-(cyclohexylmethyl)-4-morpholin-4-yl-4-oxobutanoyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](/C=N/NC(N)=O)NC(=O)[C@@H](CC(=O)N1CCOCC1)CC1CCCCC1 |
| InChI | InChI=1S/C24H41N5O6/c1-24(2,3)35-21(31)15-19(16-26-28-23(25)33)27-22(32)18(13-17-7-5-4-6-8-17)14-20(30)29-9-11-34-12-10-29/h16-19H,4-15H2,1-3H3,(H,27,32)(H3,25,28,33)/b26-16+/t18-,19+/m1/s1 |
| InChIKey | KTFNLAHABUEFCV-QVUQXXGTSA-N |
| XLogP | 1.69 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|