C20H32N2O5 — CID 91319141
2-(cyclohexylmethyl)-N-(2-methyl-4-oxooxolan-2-yl)-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 91319141) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-N-(2-methyl-4-oxooxolan-2-yl)-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | 2-(cyclohexylmethyl)-N-(2-methyl-4-oxooxolan-2-yl)-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 91319141 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-(cyclohexylmethyl)-N-(2-methyl-4-oxooxolan-2-yl)-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | CC1(NC(=O)C(CC(=O)N2CCOCC2)CC2CCCCC2)CC(=O)CO1 |
| InChI | InChI=1S/C20H32N2O5/c1-20(13-17(23)14-27-20)21-19(25)16(11-15-5-3-2-4-6-15)12-18(24)22-7-9-26-10-8-22/h15-16H,2-14H2,1H3,(H,21,25) |
| InChIKey | RUGPKMYTUPSJQE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |