C22H34N2O5 — CID 59791703
(2R)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-2-(cyclohexylmethyl)-4-morpholin-4-ylbutane-1,4-dione (PubChem CID 59791703) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is (2R)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-2-(cyclohexylmethyl)-4-morpholin-4-ylbutane-1,4-dione.
| Compound Name | (2R)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-2-(cyclohexylmethyl)-4-morpholin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 59791703 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (2R)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-2-(cyclohexylmethyl)-4-morpholin-4-ylbutane-1,4-dione |
| SMILES | O=C1CO[C@@H]2CCCN(C(=O)[C@@H](CC(=O)N3CCOCC3)CC3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C22H34N2O5/c25-18-15-29-19-7-4-8-24(21(18)19)22(27)17(13-16-5-2-1-3-6-16)14-20(26)23-9-11-28-12-10-23/h16-17,19,21H,1-15H2/t17-,19-,21-/m1/s1 |
| InChIKey | CRFRVIWNUGETTO-YFVAEKQCSA-N |
| XLogP | 1.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |