C26H36N4O6S — CID 68891330
2-(cyclohexylmethyl)-4-morpholin-4-yl-1-(6-oxo-4-pyridin-2-ylsulfonyl-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)butane-1,4-dione (PubChem CID 68891330) has the molecular formula C26H36N4O6S and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4-morpholin-4-yl-1-(6-oxo-4-pyridin-2-ylsulfonyl-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)butane-1,4-dione.
| Compound Name | 2-(cyclohexylmethyl)-4-morpholin-4-yl-1-(6-oxo-4-pyridin-2-ylsulfonyl-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 68891330 |
| Molecular Formula | C26H36N4O6S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-(cyclohexylmethyl)-4-morpholin-4-yl-1-(6-oxo-4-pyridin-2-ylsulfonyl-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)butane-1,4-dione |
| SMILES | O=C1CN(S(=O)(=O)c2ccccn2)C2CCN(C(=O)C(CC(=O)N3CCOCC3)CC3CCCCC3)C12 |
| InChI | InChI=1S/C26H36N4O6S/c31-22-18-30(37(34,35)23-8-4-5-10-27-23)21-9-11-29(25(21)22)26(33)20(16-19-6-2-1-3-7-19)17-24(32)28-12-14-36-15-13-28/h4-5,8,10,19-21,25H,1-3,6-7,9,11-18H2 |
| InChIKey | KMYKKEGWRSJTMH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 117.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |