C23H30N4O2S — CID 59001405
4-tert-butyl-2-[(4-methylbenzoyl)amino]-N-pentylpyrrolo[2,3-d][1,3]thiazole-6-carboxamide (PubChem CID 59001405) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 4-tert-butyl-2-[(4-methylbenzoyl)amino]-N-pentylpyrrolo[2,3-d][1,3]thiazole-6-carboxamide.
| Compound Name | 4-tert-butyl-2-[(4-methylbenzoyl)amino]-N-pentylpyrrolo[2,3-d][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 59001405 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-tert-butyl-2-[(4-methylbenzoyl)amino]-N-pentylpyrrolo[2,3-d][1,3]thiazole-6-carboxamide |
| SMILES | CCCCCNC(=O)c1cn(C(C)(C)C)c2nc(NC(=O)c3ccc(C)cc3)sc12 |
| InChI | InChI=1S/C23H30N4O2S/c1-6-7-8-13-24-21(29)17-14-27(23(3,4)5)19-18(17)30-22(25-19)26-20(28)16-11-9-15(2)10-12-16/h9-12,14H,6-8,13H2,1-5H3,(H,24,29)(H,25,26,28) |
| InChIKey | AYCMONUYZJPVQB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|