C23H29N5O3 — CID 68801106
7-tert-butyl-N-(2-ethoxyethyl)-2-[(4-methylbenzoyl)amino]pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 68801106) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 7-tert-butyl-N-(2-ethoxyethyl)-2-[(4-methylbenzoyl)amino]pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 7-tert-butyl-N-(2-ethoxyethyl)-2-[(4-methylbenzoyl)amino]pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 68801106 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 7-tert-butyl-N-(2-ethoxyethyl)-2-[(4-methylbenzoyl)amino]pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCOCCNC(=O)c1cn(C(C)(C)C)c2nc(NC(=O)c3ccc(C)cc3)ncc12 |
| InChI | InChI=1S/C23H29N5O3/c1-6-31-12-11-24-21(30)18-14-28(23(3,4)5)19-17(18)13-25-22(26-19)27-20(29)16-9-7-15(2)8-10-16/h7-10,13-14H,6,11-12H2,1-5H3,(H,24,30)(H,25,26,27,29) |
| InChIKey | MOLFOVHIXLQDSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|