C16H22N3S+ — CID 59002657
[7-(dimethylamino)-5a,9a,10,10a-tetrahydrophenothiazin-3-ylidene]-dimethylazanium (PubChem CID 59002657) has the molecular formula C16H22N3S+ and a molecular weight of 288.44 g/mol. Its IUPAC name is [7-(dimethylamino)-5a,9a,10,10a-tetrahydrophenothiazin-3-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-5a,9a,10,10a-tetrahydrophenothiazin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 59002657 |
| Molecular Formula | C16H22N3S+ |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [7-(dimethylamino)-5a,9a,10,10a-tetrahydrophenothiazin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)C1=CC2SC3=CC(=[N+](C)C)C=CC3NC2C=C1 |
| InChI | InChI=1S/C16H22N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10,13-15,17H,1-4H3/q+1 |
| InChIKey | ZSZFSDFTTBWSQE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|