C11H18N2S — CID 123728684
N-methyl-4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine (PubChem CID 123728684) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-methyl-4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | N-methyl-4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123728684 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-methyl-4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine |
| SMILES | CNC1C=CC(N2CCSCC2)=CC1 |
| InChI | InChI=1S/C11H18N2S/c1-12-10-2-4-11(5-3-10)13-6-8-14-9-7-13/h2,4-5,10,12H,3,6-9H2,1H3 |
| InChIKey | WXTUACHHGDGNSL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |