C10H16N2S — CID 126490185
4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine (PubChem CID 126490185) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 126490185 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-thiomorpholin-4-ylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(N2CCSCC2)=CC1 |
| InChI | InChI=1S/C10H16N2S/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12/h1,3-4,9H,2,5-8,11H2 |
| InChIKey | FPUXTRCVAUMXCS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |