C16H27N3O2S — CID 59003529
2-(1-propylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)propan-2-amine (PubChem CID 59003529) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-(1-propylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)propan-2-amine.
| Compound Name | 2-(1-propylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 59003529 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-(1-propylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)propan-2-amine |
| SMILES | CCCS(=O)(=O)N1CCC(c2ccccn2)(C(C)(C)N)CC1 |
| InChI | InChI=1S/C16H27N3O2S/c1-4-13-22(20,21)19-11-8-16(9-12-19,15(2,3)17)14-7-5-6-10-18-14/h5-7,10H,4,8-9,11-13,17H2,1-3H3 |
| InChIKey | MVMHYOVJRMNPEG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |