About 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline
6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline (PubChem CID 59005116) has the molecular formula C31H16F6N4
and a molecular weight of 558.49 g/mol. Its IUPAC name is 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline.
Molecular Properties
| Compound Name | 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline |
| PubChem CID | 59005116 |
| Molecular Formula | C31H16F6N4 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2cc(-c3ccc4ncncc4c3)ccc2-c2ccc(-c3ccc4ncncc4c3)cc21 |
| InChI | InChI=1S/C31H16F6N4/c32-30(33,34)29(31(35,36)37)25-11-19(17-3-7-27-21(9-17)13-38-15-40-27)1-5-23(25)24-6-2-20(12-26(24)29)18-4-8-28-22(10-18)14-39-16-41-28/h1-16H |
| InChIKey | ZJBOWNODUYSWNQ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline?
The IUPAC name of 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline (CID 59005116) is 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline.
What is the SMILES notation for 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline?
The canonical SMILES for 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline is FC(F)(F)C1(C(F)(F)F)c2cc(-c3ccc4ncncc4c3)ccc2-c2ccc(-c3ccc4ncncc4c3)cc21.
What is the InChIKey of 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline?
The InChIKey is ZJBOWNODUYSWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H16F6N4/c32-30(33,34)29(31(35,36)37)25-11-19(17-3-7-27-21(9-17)13-38-15-40-27)1-5-23(25)24-6-2-20(12-26(24)29)18-4-8-28-22(10-18)14-39-16-41-28/h1-16H.
What are the key properties of 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline?
6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline has a molecular weight of 558.49 g/mol, XLogP of 8.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[7-quinazolin-6-yl-9,9-bis(trifluoromethyl)fluoren-2-yl]quinazoline is sourced from PubChem (CID 59005116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).