C16H9F6IrN2O2- — CID 59005673
2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;pyridine-2-carboxylic acid (PubChem CID 59005673) has the molecular formula C16H9F6IrN2O2- and a molecular weight of 567.47 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;pyridine-2-carboxylic acid.
| Compound Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59005673 |
| Molecular Formula | C16H9F6IrN2O2- |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;iridium;pyridine-2-carboxylic acid |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C1(F)F.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C10H4F6N.C6H5NO2.Ir/c11-8(12)5-6(7-3-1-2-4-17-7)9(13,14)10(8,15)16;8-6(9)5-3-1-2-4-7-5;/h1-4H;1-4H,(H,8,9);/q-1;; |
| InChIKey | XZWFYFLPTLXJRX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|