C9H17N3O3 — CID 59006518
methyl (3R)-3-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 59006518) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl (3R)-3-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (3R)-3-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59006518 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | methyl (3R)-3-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CNC(=O)NC[C@H]1CCN(C(=O)OC)C1 |
| InChI | InChI=1S/C9H17N3O3/c1-10-8(13)11-5-7-3-4-12(6-7)9(14)15-2/h7H,3-6H2,1-2H3,(H2,10,11,13)/t7-/m1/s1 |
| InChIKey | GUGSZAZCTJAQRF-SSDOTTSWSA-N |
| XLogP | 0.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |