C21H15BrFN3O2S — CID 59007906
2-[2-[(E)-2-(5-bromo-2-fluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 59007906) has the molecular formula C21H15BrFN3O2S and a molecular weight of 472.34 g/mol. Its IUPAC name is 2-[2-[(E)-2-(5-bromo-2-fluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-[(E)-2-(5-bromo-2-fluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 59007906 |
| Molecular Formula | C21H15BrFN3O2S |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-[2-[(E)-2-(5-bromo-2-fluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3cc(Br)ccc3F)[nH]c2c1 |
| InChI | InChI=1S/C21H15BrFN3O2S/c22-15-7-8-17(23)14(11-15)6-10-21-25-18-9-5-13(12-19(18)26-21)16-3-1-2-4-20(16)29(24,27)28/h1-12H,(H,25,26)(H2,24,27,28)/b10-6+ |
| InChIKey | HJQXOKMZCBVVFW-UXBLZVDNSA-N |
| XLogP | 4.95 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |